C25H23N3O4 — CID 22556870
3-[10-(hydroxymethyl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl]-4-(6-methoxy-1H-indol-3-yl)pyrrolidine-2,5-dione (PubChem CID 22556870) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is 3-[10-(hydroxymethyl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl]-4-(6-methoxy-1H-indol-3-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-[10-(hydroxymethyl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl]-4-(6-methoxy-1H-indol-3-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 22556870 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 3-[10-(hydroxymethyl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl]-4-(6-methoxy-1H-indol-3-yl)pyrrolidine-2,5-dione |
| SMILES | COc1ccc2c(C3C(=O)NC(=O)C3c3cn4c5c(cccc35)CC(CO)C4)c[nH]c2c1 |
| InChI | InChI=1S/C25H23N3O4/c1-32-15-5-6-16-18(9-26-20(16)8-15)21-22(25(31)27-24(21)30)19-11-28-10-13(12-29)7-14-3-2-4-17(19)23(14)28/h2-6,8-9,11,13,21-22,26,29H,7,10,12H2,1H3,(H,27,30,31) |
| InChIKey | ZEXCFXKYMKBTTE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|