About 2-(1H-indol-7-yl)ethanol
2-(1H-indol-7-yl)ethanol (PubChem CID 22556873) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 2-(1H-indol-7-yl)ethanol.
Molecular Properties
| Compound Name | 2-(1H-indol-7-yl)ethanol |
| PubChem CID | 22556873 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 2-(1H-indol-7-yl)ethanol |
| SMILES | OCCc1cccc2cc[nH]c12 |
| InChI | InChI=1S/C10H11NO/c12-7-5-9-3-1-2-8-4-6-11-10(8)9/h1-4,6,11-12H,5,7H2 |
| InChIKey | URTUZTSLWOONOL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(1H-indol-7-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-indol-7-yl)ethanol?
The IUPAC name of 2-(1H-indol-7-yl)ethanol (CID 22556873) is 2-(1H-indol-7-yl)ethanol.
What is the SMILES notation for 2-(1H-indol-7-yl)ethanol?
The canonical SMILES for 2-(1H-indol-7-yl)ethanol is OCCc1cccc2cc[nH]c12.
What is the InChIKey of 2-(1H-indol-7-yl)ethanol?
The InChIKey is URTUZTSLWOONOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c12-7-5-9-3-1-2-8-4-6-11-10(8)9/h1-4,6,11-12H,5,7H2.
What are the key properties of 2-(1H-indol-7-yl)ethanol?
2-(1H-indol-7-yl)ethanol has a molecular weight of 161.20 g/mol, XLogP of 1.70, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-indol-7-yl)ethanol is sourced from PubChem (CID 22556873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).