About 7,7a-dihydrothiopyrano[2,3-b]pyrrole
7,7a-dihydrothiopyrano[2,3-b]pyrrole (PubChem CID 22556929) has the molecular formula C7H7NS
and a molecular weight of 137.21 g/mol. Its IUPAC name is 7,7a-dihydrothiopyrano[2,3-b]pyrrole.
Molecular Properties
| Compound Name | 7,7a-dihydrothiopyrano[2,3-b]pyrrole |
| PubChem CID | 22556929 |
| Molecular Formula | C7H7NS |
| Molecular Weight | 137.21 g/mol |
| Exact Mass | 137.03 |
| IUPAC Name | 7,7a-dihydrothiopyrano[2,3-b]pyrrole |
| SMILES | C1=CSC2NC=CC2=C1 |
| InChI | InChI=1S/C7H7NS/c1-2-6-3-4-8-7(6)9-5-1/h1-5,7-8H |
| InChIKey | YTOJMOLFOWZWBA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,7a-dihydrothiopyrano[2,3-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7a-dihydrothiopyrano[2,3-b]pyrrole?
The IUPAC name of 7,7a-dihydrothiopyrano[2,3-b]pyrrole (CID 22556929) is 7,7a-dihydrothiopyrano[2,3-b]pyrrole.
What is the SMILES notation for 7,7a-dihydrothiopyrano[2,3-b]pyrrole?
The canonical SMILES for 7,7a-dihydrothiopyrano[2,3-b]pyrrole is C1=CSC2NC=CC2=C1.
What is the InChIKey of 7,7a-dihydrothiopyrano[2,3-b]pyrrole?
The InChIKey is YTOJMOLFOWZWBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NS/c1-2-6-3-4-8-7(6)9-5-1/h1-5,7-8H.
What are the key properties of 7,7a-dihydrothiopyrano[2,3-b]pyrrole?
7,7a-dihydrothiopyrano[2,3-b]pyrrole has a molecular weight of 137.21 g/mol, XLogP of 1.62, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7a-dihydrothiopyrano[2,3-b]pyrrole is sourced from PubChem (CID 22556929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).