C15H16F3N3O — CID 22557093
3a-benzyl-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-one (PubChem CID 22557093) has the molecular formula C15H16F3N3O and a molecular weight of 311.31 g/mol. Its IUPAC name is 3a-benzyl-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-one.
| Compound Name | 3a-benzyl-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-one |
|---|---|
| PubChem CID | 22557093 |
| Molecular Formula | C15H16F3N3O |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 3a-benzyl-2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-one |
| SMILES | O=C1N(CC(F)(F)F)N=C2CCNCC12Cc1ccccc1 |
| InChI | InChI=1S/C15H16F3N3O/c16-15(17,18)10-21-13(22)14(8-11-4-2-1-3-5-11)9-19-7-6-12(14)20-21/h1-5,19H,6-10H2 |
| InChIKey | MFDUGPLSFXIPKE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |