About 4-(2,5-dimethylpyrrol-1-yl)piperidine
4-(2,5-dimethylpyrrol-1-yl)piperidine (PubChem CID 22557716) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 4-(2,5-dimethylpyrrol-1-yl)piperidine.
Molecular Properties
| Compound Name | 4-(2,5-dimethylpyrrol-1-yl)piperidine |
| PubChem CID | 22557716 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 4-(2,5-dimethylpyrrol-1-yl)piperidine |
| SMILES | Cc1ccc(C)n1C1CCNCC1 |
| InChI | InChI=1S/C11H18N2/c1-9-3-4-10(2)13(9)11-5-7-12-8-6-11/h3-4,11-12H,5-8H2,1-2H3 |
| InChIKey | LFUQYNQNHALJCO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2,5-dimethylpyrrol-1-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dimethylpyrrol-1-yl)piperidine?
The IUPAC name of 4-(2,5-dimethylpyrrol-1-yl)piperidine (CID 22557716) is 4-(2,5-dimethylpyrrol-1-yl)piperidine.
What is the SMILES notation for 4-(2,5-dimethylpyrrol-1-yl)piperidine?
The canonical SMILES for 4-(2,5-dimethylpyrrol-1-yl)piperidine is Cc1ccc(C)n1C1CCNCC1.
What is the InChIKey of 4-(2,5-dimethylpyrrol-1-yl)piperidine?
The InChIKey is LFUQYNQNHALJCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2/c1-9-3-4-10(2)13(9)11-5-7-12-8-6-11/h3-4,11-12H,5-8H2,1-2H3.
What are the key properties of 4-(2,5-dimethylpyrrol-1-yl)piperidine?
4-(2,5-dimethylpyrrol-1-yl)piperidine has a molecular weight of 178.28 g/mol, XLogP of 2.03, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dimethylpyrrol-1-yl)piperidine is sourced from PubChem (CID 22557716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).