C28H32ClF3N2O4 — CID 22557804
N-[4-(trifluoromethoxy)phenyl]-N-[[3-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperidin-4-amine;hydrochloride (PubChem CID 22557804) has the molecular formula C28H32ClF3N2O4 and a molecular weight of 553.02 g/mol. Its IUPAC name is N-[4-(trifluoromethoxy)phenyl]-N-[[3-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperidin-4-amine;hydrochloride.
| Compound Name | N-[4-(trifluoromethoxy)phenyl]-N-[[3-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 22557804 |
| Molecular Formula | C28H32ClF3N2O4 |
| Molecular Weight | 553.02 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | N-[4-(trifluoromethoxy)phenyl]-N-[[3-(3,4,5-trimethoxyphenyl)phenyl]methyl]piperidin-4-amine;hydrochloride |
| SMILES | COc1cc(-c2cccc(CN(c3ccc(OC(F)(F)F)cc3)C3CCNCC3)c2)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C28H31F3N2O4.ClH/c1-34-25-16-21(17-26(35-2)27(25)36-3)20-6-4-5-19(15-20)18-33(23-11-13-32-14-12-23)22-7-9-24(10-8-22)37-28(29,30)31;/h4-10,15-17,23,32H,11-14,18H2,1-3H3;1H |
| InChIKey | UWAYRPQFJOOPHC-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.02 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|