About N-[[2-(3,4-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)piperidin-4-amine
N-[[2-(3,4-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)piperidin-4-amine (PubChem CID 22557931) has the molecular formula C24H25F2N3O
and a molecular weight of 409.48 g/mol. Its IUPAC name is N-[[2-(3,4-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)piperidin-4-amine.
Molecular Properties
| Compound Name | N-[[2-(3,4-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)piperidin-4-amine |
| PubChem CID | 22557931 |
| Molecular Formula | C24H25F2N3O |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | N-[[2-(3,4-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)piperidin-4-amine |
| SMILES | COc1ccc(N(Cc2ccnc(-c3ccc(F)c(F)c3)c2)C2CCNCC2)cc1 |
| InChI | InChI=1S/C24H25F2N3O/c1-30-21-5-3-19(4-6-21)29(20-9-11-27-12-10-20)16-17-8-13-28-24(14-17)18-2-7-22(25)23(26)15-18/h2-8,13-15,20,27H,9-12,16H2,1H3 |
| InChIKey | XBWCSRBWCPFVEY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-[[2-(3,4-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(3,4-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)piperidin-4-amine?
The IUPAC name of N-[[2-(3,4-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)piperidin-4-amine (CID 22557931) is N-[[2-(3,4-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)piperidin-4-amine.
What is the SMILES notation for N-[[2-(3,4-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)piperidin-4-amine?
The canonical SMILES for N-[[2-(3,4-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)piperidin-4-amine is COc1ccc(N(Cc2ccnc(-c3ccc(F)c(F)c3)c2)C2CCNCC2)cc1.
What is the InChIKey of N-[[2-(3,4-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)piperidin-4-amine?
The InChIKey is XBWCSRBWCPFVEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25F2N3O/c1-30-21-5-3-19(4-6-21)29(20-9-11-27-12-10-20)16-17-8-13-28-24(14-17)18-2-7-22(25)23(26)15-18/h2-8,13-15,20,27H,9-12,16H2,1H3.
What are the key properties of N-[[2-(3,4-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)piperidin-4-amine?
N-[[2-(3,4-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)piperidin-4-amine has a molecular weight of 409.48 g/mol, XLogP of 4.79, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(3,4-difluorophenyl)-4-pyridinyl]methyl]-N-(4-methoxyphenyl)piperidin-4-amine is sourced from PubChem (CID 22557931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).