About 5,7-dichloro-2-(4-methyl-4-prop-2-enylpiperazin-4-ium-1-yl)-1,3-benzoxazole bromide
5,7-dichloro-2-(4-methyl-4-prop-2-enylpiperazin-4-ium-1-yl)-1,3-benzoxazole bromide (PubChem CID 22558215) has the molecular formula C15H18BrCl2N3O
and a molecular weight of 407.14 g/mol. Its IUPAC name is 5,7-dichloro-2-(4-methyl-4-prop-2-enylpiperazin-4-ium-1-yl)-1,3-benzoxazole bromide.
Molecular Properties
| Compound Name | 5,7-dichloro-2-(4-methyl-4-prop-2-enylpiperazin-4-ium-1-yl)-1,3-benzoxazole bromide |
| PubChem CID | 22558215 |
| Molecular Formula | C15H18BrCl2N3O |
| Molecular Weight | 407.14 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | 5,7-dichloro-2-(4-methyl-4-prop-2-enylpiperazin-4-ium-1-yl)-1,3-benzoxazole bromide |
| SMILES | C=CC[N+]1(C)CCN(c2nc3cc(Cl)cc(Cl)c3o2)CC1.[Br-] |
| InChI | InChI=1S/C15H18Cl2N3O.BrH/c1-3-6-20(2)7-4-19(5-8-20)15-18-13-10-11(16)9-12(17)14(13)21-15;/h3,9-10H,1,4-8H2,2H3;1H/q+1;/p-1 |
| InChIKey | YSLAFISYZRMLHR-UHFFFAOYSA-M |
| XLogP | 0.59 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.14 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dichloro-2-(4-methyl-4-prop-2-enylpiperazin-4-ium-1-yl)-1,3-benzoxazole bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-2-(4-methyl-4-prop-2-enylpiperazin-4-ium-1-yl)-1,3-benzoxazole bromide?
The IUPAC name of 5,7-dichloro-2-(4-methyl-4-prop-2-enylpiperazin-4-ium-1-yl)-1,3-benzoxazole bromide (CID 22558215) is 5,7-dichloro-2-(4-methyl-4-prop-2-enylpiperazin-4-ium-1-yl)-1,3-benzoxazole bromide.
What is the SMILES notation for 5,7-dichloro-2-(4-methyl-4-prop-2-enylpiperazin-4-ium-1-yl)-1,3-benzoxazole bromide?
The canonical SMILES for 5,7-dichloro-2-(4-methyl-4-prop-2-enylpiperazin-4-ium-1-yl)-1,3-benzoxazole bromide is C=CC[N+]1(C)CCN(c2nc3cc(Cl)cc(Cl)c3o2)CC1.[Br-].
What is the InChIKey of 5,7-dichloro-2-(4-methyl-4-prop-2-enylpiperazin-4-ium-1-yl)-1,3-benzoxazole bromide?
The InChIKey is YSLAFISYZRMLHR-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H18Cl2N3O.BrH/c1-3-6-20(2)7-4-19(5-8-20)15-18-13-10-11(16)9-12(17)14(13)21-15;/h3,9-10H,1,4-8H2,2H3;1H/q+1;/p-1.
What are the key properties of 5,7-dichloro-2-(4-methyl-4-prop-2-enylpiperazin-4-ium-1-yl)-1,3-benzoxazole bromide?
5,7-dichloro-2-(4-methyl-4-prop-2-enylpiperazin-4-ium-1-yl)-1,3-benzoxazole bromide has a molecular weight of 407.14 g/mol, XLogP of 0.59, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-2-(4-methyl-4-prop-2-enylpiperazin-4-ium-1-yl)-1,3-benzoxazole bromide is sourced from PubChem (CID 22558215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).