About cyclohexane;2-propan-2-yloxypropane
cyclohexane;2-propan-2-yloxypropane (PubChem CID 22558525) has the molecular formula C12H26O
and a molecular weight of 186.34 g/mol. Its IUPAC name is cyclohexane;2-propan-2-yloxypropane.
Molecular Properties
| Compound Name | cyclohexane;2-propan-2-yloxypropane |
| PubChem CID | 22558525 |
| Molecular Formula | C12H26O |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.20 |
| IUPAC Name | cyclohexane;2-propan-2-yloxypropane |
| SMILES | C1CCCCC1.CC(C)OC(C)C |
| InChI | InChI=1S/C6H14O.C6H12/c1-5(2)7-6(3)4;1-2-4-6-5-3-1/h5-6H,1-4H3;1-6H2 |
| InChIKey | FBKCZNJUQYDVPL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohexane;2-propan-2-yloxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;2-propan-2-yloxypropane?
The IUPAC name of cyclohexane;2-propan-2-yloxypropane (CID 22558525) is cyclohexane;2-propan-2-yloxypropane.
What is the SMILES notation for cyclohexane;2-propan-2-yloxypropane?
The canonical SMILES for cyclohexane;2-propan-2-yloxypropane is C1CCCCC1.CC(C)OC(C)C.
What is the InChIKey of cyclohexane;2-propan-2-yloxypropane?
The InChIKey is FBKCZNJUQYDVPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.C6H12/c1-5(2)7-6(3)4;1-2-4-6-5-3-1/h5-6H,1-4H3;1-6H2.
What are the key properties of cyclohexane;2-propan-2-yloxypropane?
cyclohexane;2-propan-2-yloxypropane has a molecular weight of 186.34 g/mol, XLogP of 4.16, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;2-propan-2-yloxypropane is sourced from PubChem (CID 22558525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).