About 2-(4-tert-butylphenyl)-2,6-dimethylcyclohexan-1-one
2-(4-tert-butylphenyl)-2,6-dimethylcyclohexan-1-one (PubChem CID 22558549) has the molecular formula C18H26O
and a molecular weight of 258.40 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-2,6-dimethylcyclohexan-1-one.
Molecular Properties
| Compound Name | 2-(4-tert-butylphenyl)-2,6-dimethylcyclohexan-1-one |
| PubChem CID | 22558549 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 2-(4-tert-butylphenyl)-2,6-dimethylcyclohexan-1-one |
| SMILES | CC1CCCC(C)(c2ccc(C(C)(C)C)cc2)C1=O |
| InChI | InChI=1S/C18H26O/c1-13-7-6-12-18(5,16(13)19)15-10-8-14(9-11-15)17(2,3)4/h8-11,13H,6-7,12H2,1-5H3 |
| InChIKey | VDJGAYYLOVHKQN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-tert-butylphenyl)-2,6-dimethylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-tert-butylphenyl)-2,6-dimethylcyclohexan-1-one?
The IUPAC name of 2-(4-tert-butylphenyl)-2,6-dimethylcyclohexan-1-one (CID 22558549) is 2-(4-tert-butylphenyl)-2,6-dimethylcyclohexan-1-one.
What is the SMILES notation for 2-(4-tert-butylphenyl)-2,6-dimethylcyclohexan-1-one?
The canonical SMILES for 2-(4-tert-butylphenyl)-2,6-dimethylcyclohexan-1-one is CC1CCCC(C)(c2ccc(C(C)(C)C)cc2)C1=O.
What is the InChIKey of 2-(4-tert-butylphenyl)-2,6-dimethylcyclohexan-1-one?
The InChIKey is VDJGAYYLOVHKQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O/c1-13-7-6-12-18(5,16(13)19)15-10-8-14(9-11-15)17(2,3)4/h8-11,13H,6-7,12H2,1-5H3.
What are the key properties of 2-(4-tert-butylphenyl)-2,6-dimethylcyclohexan-1-one?
2-(4-tert-butylphenyl)-2,6-dimethylcyclohexan-1-one has a molecular weight of 258.40 g/mol, XLogP of 4.63, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-tert-butylphenyl)-2,6-dimethylcyclohexan-1-one is sourced from PubChem (CID 22558549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).