About CID 22558571
CID 22558571 (PubChem CID 22558571) has the molecular formula C9H18NO2SSi
and a molecular weight of 232.40 g/mol.
Molecular Properties
| Compound Name | CID 22558571 |
| PubChem CID | 22558571 |
| Molecular Formula | C9H18NO2SSi |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | — |
| SMILES | CCO[Si](CCCCSC#N)OCC |
| InChI | InChI=1S/C9H18NO2SSi/c1-3-11-14(12-4-2)8-6-5-7-13-9-10/h3-8H2,1-2H3 |
| InChIKey | FLCXZWKVZMVMOU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22558571 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22558571?
The IUPAC name of CID 22558571 (CID 22558571) is not available.
What is the SMILES notation for CID 22558571?
The canonical SMILES for CID 22558571 is CCO[Si](CCCCSC#N)OCC.
What is the InChIKey of CID 22558571?
The InChIKey is FLCXZWKVZMVMOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18NO2SSi/c1-3-11-14(12-4-2)8-6-5-7-13-9-10/h3-8H2,1-2H3.
What are the key properties of CID 22558571?
CID 22558571 has a molecular weight of 232.40 g/mol, XLogP of 2.54, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22558571 is sourced from PubChem (CID 22558571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).