About 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-fluoro-5-(1-methylindazol-5-yl)phenyl]propanoic acid
3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-fluoro-5-(1-methylindazol-5-yl)phenyl]propanoic acid (PubChem CID 22558585) has the molecular formula C26H23FN2O3
and a molecular weight of 430.48 g/mol. Its IUPAC name is 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-fluoro-5-(1-methylindazol-5-yl)phenyl]propanoic acid.
Molecular Properties
| Compound Name | 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-fluoro-5-(1-methylindazol-5-yl)phenyl]propanoic acid |
| PubChem CID | 22558585 |
| Molecular Formula | C26H23FN2O3 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-fluoro-5-(1-methylindazol-5-yl)phenyl]propanoic acid |
| SMILES | Cn1ncc2cc(-c3cc(CCC(=O)O)cc(F)c3OC3Cc4ccccc4C3)ccc21 |
| InChI | InChI=1S/C26H23FN2O3/c1-29-24-8-7-19(12-20(24)15-28-29)22-10-16(6-9-25(30)31)11-23(27)26(22)32-21-13-17-4-2-3-5-18(17)14-21/h2-5,7-8,10-12,15,21H,6,9,13-14H2,1H3,(H,30,31) |
| InChIKey | YGSQDKBDDHPKSI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-fluoro-5-(1-methylindazol-5-yl)phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-fluoro-5-(1-methylindazol-5-yl)phenyl]propanoic acid?
The IUPAC name of 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-fluoro-5-(1-methylindazol-5-yl)phenyl]propanoic acid (CID 22558585) is 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-fluoro-5-(1-methylindazol-5-yl)phenyl]propanoic acid.
What is the SMILES notation for 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-fluoro-5-(1-methylindazol-5-yl)phenyl]propanoic acid?
The canonical SMILES for 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-fluoro-5-(1-methylindazol-5-yl)phenyl]propanoic acid is Cn1ncc2cc(-c3cc(CCC(=O)O)cc(F)c3OC3Cc4ccccc4C3)ccc21.
What is the InChIKey of 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-fluoro-5-(1-methylindazol-5-yl)phenyl]propanoic acid?
The InChIKey is YGSQDKBDDHPKSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23FN2O3/c1-29-24-8-7-19(12-20(24)15-28-29)22-10-16(6-9-25(30)31)11-23(27)26(22)32-21-13-17-4-2-3-5-18(17)14-21/h2-5,7-8,10-12,15,21H,6,9,13-14H2,1H3,(H,30,31).
What are the key properties of 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-fluoro-5-(1-methylindazol-5-yl)phenyl]propanoic acid?
3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-fluoro-5-(1-methylindazol-5-yl)phenyl]propanoic acid has a molecular weight of 430.48 g/mol, XLogP of 4.94, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-fluoro-5-(1-methylindazol-5-yl)phenyl]propanoic acid is sourced from PubChem (CID 22558585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).