(7-hydroxynaphthalen-2-yl)boronic acid

C10H9BO3 — CID 22558652

IUPAC(7-hydroxynaphthalen-2-yl)boronic acid
SMILESOB(O)c1ccc2ccc(O)cc2c1
InChIInChI=1S/C10H9BO3/c12-10-4-2-7-1-3-9(11(13)14)5-8(7)6-10/h1-6,12-14H
InChIKeyMZWUEPMDFICBJA-UHFFFAOYSA-N
MW187.99 g/mol
LogP0.23
Rot. Bonds1

About (7-hydroxynaphthalen-2-yl)boronic acid

(7-hydroxynaphthalen-2-yl)boronic acid (PubChem CID 22558652) has the molecular formula C10H9BO3 and a molecular weight of 187.99 g/mol. Its IUPAC name is (7-hydroxynaphthalen-2-yl)boronic acid.

Molecular Properties

Compound Name(7-hydroxynaphthalen-2-yl)boronic acid
PubChem CID22558652
Molecular FormulaC10H9BO3
Molecular Weight187.99 g/mol
Exact Mass188.06
IUPAC Name(7-hydroxynaphthalen-2-yl)boronic acid
SMILESOB(O)c1ccc2ccc(O)cc2c1
InChIInChI=1S/C10H9BO3/c12-10-4-2-7-1-3-9(11(13)14)5-8(7)6-10/h1-6,12-14H
InChIKeyMZWUEPMDFICBJA-UHFFFAOYSA-N
XLogP0.23
TPSA60.69 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.99
LogP ≤ 50.23
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (7-hydroxynaphthalen-2-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (7-hydroxynaphthalen-2-yl)boronic acid?
The IUPAC name of (7-hydroxynaphthalen-2-yl)boronic acid (CID 22558652) is (7-hydroxynaphthalen-2-yl)boronic acid.
What is the SMILES notation for (7-hydroxynaphthalen-2-yl)boronic acid?
The canonical SMILES for (7-hydroxynaphthalen-2-yl)boronic acid is OB(O)c1ccc2ccc(O)cc2c1.
What is the InChIKey of (7-hydroxynaphthalen-2-yl)boronic acid?
The InChIKey is MZWUEPMDFICBJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BO3/c12-10-4-2-7-1-3-9(11(13)14)5-8(7)6-10/h1-6,12-14H.
What are the key properties of (7-hydroxynaphthalen-2-yl)boronic acid?
(7-hydroxynaphthalen-2-yl)boronic acid has a molecular weight of 187.99 g/mol, XLogP of 0.23, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-hydroxynaphthalen-2-yl)boronic acid is sourced from PubChem (CID 22558652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).