C25H23ClN2O3 — CID 22558732
3-[4-[2-(2-chlorophenyl)ethoxy]-3-(1-methylindazol-5-yl)phenyl]propanoic acid (PubChem CID 22558732) has the molecular formula C25H23ClN2O3 and a molecular weight of 434.92 g/mol. Its IUPAC name is 3-[4-[2-(2-chlorophenyl)ethoxy]-3-(1-methylindazol-5-yl)phenyl]propanoic acid.
| Compound Name | 3-[4-[2-(2-chlorophenyl)ethoxy]-3-(1-methylindazol-5-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 22558732 |
| Molecular Formula | C25H23ClN2O3 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 3-[4-[2-(2-chlorophenyl)ethoxy]-3-(1-methylindazol-5-yl)phenyl]propanoic acid |
| SMILES | Cn1ncc2cc(-c3cc(CCC(=O)O)ccc3OCCc3ccccc3Cl)ccc21 |
| InChI | InChI=1S/C25H23ClN2O3/c1-28-23-9-8-19(15-20(23)16-27-28)21-14-17(7-11-25(29)30)6-10-24(21)31-13-12-18-4-2-3-5-22(18)26/h2-6,8-10,14-16H,7,11-13H2,1H3,(H,29,30) |
| InChIKey | XFQWZHYEDXFJFB-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |