C26H23F3N2O3 — CID 22558904
3-[3-(1-ethylindazol-5-yl)-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]propanoic acid (PubChem CID 22558904) has the molecular formula C26H23F3N2O3 and a molecular weight of 468.48 g/mol. Its IUPAC name is 3-[3-(1-ethylindazol-5-yl)-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]propanoic acid.
| Compound Name | 3-[3-(1-ethylindazol-5-yl)-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22558904 |
| Molecular Formula | C26H23F3N2O3 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 3-[3-(1-ethylindazol-5-yl)-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]propanoic acid |
| SMILES | CCn1ncc2cc(-c3cc(CCC(=O)O)ccc3OCc3ccc(C(F)(F)F)cc3)ccc21 |
| InChI | InChI=1S/C26H23F3N2O3/c1-2-31-23-10-7-19(14-20(23)15-30-31)22-13-17(6-12-25(32)33)5-11-24(22)34-16-18-3-8-21(9-4-18)26(27,28)29/h3-5,7-11,13-15H,2,6,12,16H2,1H3,(H,32,33) |
| InChIKey | FIZRDBSYRPDKOU-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |