About 5-bromo-2-ethylindazole
5-bromo-2-ethylindazole (PubChem CID 22558977) has the molecular formula C9H9BrN2
and a molecular weight of 225.09 g/mol. Its IUPAC name is 5-bromo-2-ethylindazole.
Molecular Properties
| Compound Name | 5-bromo-2-ethylindazole |
| PubChem CID | 22558977 |
| Molecular Formula | C9H9BrN2 |
| Molecular Weight | 225.09 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | 5-bromo-2-ethylindazole |
| SMILES | CCn1cc2cc(Br)ccc2n1 |
| InChI | InChI=1S/C9H9BrN2/c1-2-12-6-7-5-8(10)3-4-9(7)11-12/h3-6H,2H2,1H3 |
| InChIKey | HQGWVFUIGSFDSL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.09 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-2-ethylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-ethylindazole?
The IUPAC name of 5-bromo-2-ethylindazole (CID 22558977) is 5-bromo-2-ethylindazole.
What is the SMILES notation for 5-bromo-2-ethylindazole?
The canonical SMILES for 5-bromo-2-ethylindazole is CCn1cc2cc(Br)ccc2n1.
What is the InChIKey of 5-bromo-2-ethylindazole?
The InChIKey is HQGWVFUIGSFDSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN2/c1-2-12-6-7-5-8(10)3-4-9(7)11-12/h3-6H,2H2,1H3.
What are the key properties of 5-bromo-2-ethylindazole?
5-bromo-2-ethylindazole has a molecular weight of 225.09 g/mol, XLogP of 2.82, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-ethylindazole is sourced from PubChem (CID 22558977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).