C26H25FN2O3 — CID 22559115
methyl 3-[4-[2-(2-fluorophenyl)ethoxy]-3-(1-methylindazol-5-yl)phenyl]propanoate (PubChem CID 22559115) has the molecular formula C26H25FN2O3 and a molecular weight of 432.50 g/mol. Its IUPAC name is methyl 3-[4-[2-(2-fluorophenyl)ethoxy]-3-(1-methylindazol-5-yl)phenyl]propanoate.
| Compound Name | methyl 3-[4-[2-(2-fluorophenyl)ethoxy]-3-(1-methylindazol-5-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 22559115 |
| Molecular Formula | C26H25FN2O3 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | methyl 3-[4-[2-(2-fluorophenyl)ethoxy]-3-(1-methylindazol-5-yl)phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OCCc2ccccc2F)c(-c2ccc3c(cnn3C)c2)c1 |
| InChI | InChI=1S/C26H25FN2O3/c1-29-24-10-9-20(16-21(24)17-28-29)22-15-18(8-12-26(30)31-2)7-11-25(22)32-14-13-19-5-3-4-6-23(19)27/h3-7,9-11,15-17H,8,12-14H2,1-2H3 |
| InChIKey | CRMJPFAAWNKRHT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |