About methyl 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-(1H-indazol-5-yl)phenyl]propanoate
methyl 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-(1H-indazol-5-yl)phenyl]propanoate (PubChem CID 22559222) has the molecular formula C26H24N2O3
and a molecular weight of 412.49 g/mol. Its IUPAC name is methyl 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-(1H-indazol-5-yl)phenyl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-(1H-indazol-5-yl)phenyl]propanoate |
| PubChem CID | 22559222 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | methyl 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-(1H-indazol-5-yl)phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OC2Cc3ccccc3C2)c(-c2ccc3[nH]ncc3c2)c1 |
| InChI | InChI=1S/C26H24N2O3/c1-30-26(29)11-7-17-6-10-25(31-22-14-18-4-2-3-5-19(18)15-22)23(12-17)20-8-9-24-21(13-20)16-27-28-24/h2-6,8-10,12-13,16,22H,7,11,14-15H2,1H3,(H,27,28) |
| InChIKey | DPVBCHODOXMYEC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-(1H-indazol-5-yl)phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-(1H-indazol-5-yl)phenyl]propanoate?
The IUPAC name of methyl 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-(1H-indazol-5-yl)phenyl]propanoate (CID 22559222) is methyl 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-(1H-indazol-5-yl)phenyl]propanoate.
What is the SMILES notation for methyl 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-(1H-indazol-5-yl)phenyl]propanoate?
The canonical SMILES for methyl 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-(1H-indazol-5-yl)phenyl]propanoate is COC(=O)CCc1ccc(OC2Cc3ccccc3C2)c(-c2ccc3[nH]ncc3c2)c1.
What is the InChIKey of methyl 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-(1H-indazol-5-yl)phenyl]propanoate?
The InChIKey is DPVBCHODOXMYEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N2O3/c1-30-26(29)11-7-17-6-10-25(31-22-14-18-4-2-3-5-19(18)15-22)23(12-17)20-8-9-24-21(13-20)16-27-28-24/h2-6,8-10,12-13,16,22H,7,11,14-15H2,1H3,(H,27,28).
What are the key properties of methyl 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-(1H-indazol-5-yl)phenyl]propanoate?
methyl 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-(1H-indazol-5-yl)phenyl]propanoate has a molecular weight of 412.49 g/mol, XLogP of 4.88, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[4-(2,3-dihydro-1H-inden-2-yloxy)-3-(1H-indazol-5-yl)phenyl]propanoate is sourced from PubChem (CID 22559222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).