C20H24O3 — CID 22559980
7,10,13-trimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11,17-trione (PubChem CID 22559980) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 7,10,13-trimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11,17-trione.
| Compound Name | 7,10,13-trimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11,17-trione |
|---|---|
| PubChem CID | 22559980 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 7,10,13-trimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11,17-trione |
| SMILES | CC1CC2=CC(=O)C=CC2(C)C2C(=O)CC3(C)C(=O)CCC3C12 |
| InChI | InChI=1S/C20H24O3/c1-11-8-12-9-13(21)6-7-19(12,2)18-15(22)10-20(3)14(17(11)18)4-5-16(20)23/h6-7,9,11,14,17-18H,4-5,8,10H2,1-3H3 |
| InChIKey | FHJPPZITVBOJIJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |