C10H7F6NO3S — CID 2256008
(1,1,1,3,3,3-hexafluoropropan-2-ylideneamino) 4-methylbenzenesulfonate (PubChem CID 2256008) has the molecular formula C10H7F6NO3S and a molecular weight of 335.23 g/mol. Its IUPAC name is (1,1,1,3,3,3-hexafluoropropan-2-ylideneamino) 4-methylbenzenesulfonate.
| Compound Name | (1,1,1,3,3,3-hexafluoropropan-2-ylideneamino) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 2256008 |
| Molecular Formula | C10H7F6NO3S |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | (1,1,1,3,3,3-hexafluoropropan-2-ylideneamino) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ON=C(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H7F6NO3S/c1-6-2-4-7(5-3-6)21(18,19)20-17-8(9(11,12)13)10(14,15)16/h2-5H,1H3 |
| InChIKey | GZKJHNQWQJQANR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|