About 8H-pyrido[1,2-c]pyrimidine
8H-pyrido[1,2-c]pyrimidine (PubChem CID 22560221) has the molecular formula C8H8N2
and a molecular weight of 132.17 g/mol. Its IUPAC name is 8H-pyrido[1,2-c]pyrimidine.
Molecular Properties
| Compound Name | 8H-pyrido[1,2-c]pyrimidine |
| PubChem CID | 22560221 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 8H-pyrido[1,2-c]pyrimidine |
| SMILES | C1=CCN2C=NC=CC2=C1 |
| InChI | InChI=1S/C8H8N2/c1-2-6-10-7-9-5-4-8(10)3-1/h1-5,7H,6H2 |
| InChIKey | GOGDIBUQCZYYSP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8H-pyrido[1,2-c]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8H-pyrido[1,2-c]pyrimidine?
The IUPAC name of 8H-pyrido[1,2-c]pyrimidine (CID 22560221) is 8H-pyrido[1,2-c]pyrimidine.
What is the SMILES notation for 8H-pyrido[1,2-c]pyrimidine?
The canonical SMILES for 8H-pyrido[1,2-c]pyrimidine is C1=CCN2C=NC=CC2=C1.
What is the InChIKey of 8H-pyrido[1,2-c]pyrimidine?
The InChIKey is GOGDIBUQCZYYSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2/c1-2-6-10-7-9-5-4-8(10)3-1/h1-5,7H,6H2.
What are the key properties of 8H-pyrido[1,2-c]pyrimidine?
8H-pyrido[1,2-c]pyrimidine has a molecular weight of 132.17 g/mol, XLogP of 1.30, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8H-pyrido[1,2-c]pyrimidine is sourced from PubChem (CID 22560221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).