C22H26N6O3 — CID 22560537
3-(1,3-benzodioxol-5-yl)-N-[3-[(2-imidazol-1-yl-6-methylpyrimidin-4-yl)-methylamino]propyl]propanamide (PubChem CID 22560537) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[3-[(2-imidazol-1-yl-6-methylpyrimidin-4-yl)-methylamino]propyl]propanamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[3-[(2-imidazol-1-yl-6-methylpyrimidin-4-yl)-methylamino]propyl]propanamide |
|---|---|
| PubChem CID | 22560537 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[3-[(2-imidazol-1-yl-6-methylpyrimidin-4-yl)-methylamino]propyl]propanamide |
| SMILES | Cc1cc(N(C)CCCNC(=O)CCc2ccc3c(c2)OCO3)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C22H26N6O3/c1-16-12-20(26-22(25-16)28-11-9-23-14-28)27(2)10-3-8-24-21(29)7-5-17-4-6-18-19(13-17)31-15-30-18/h4,6,9,11-14H,3,5,7-8,10,15H2,1-2H3,(H,24,29) |
| InChIKey | QWSINOLUWKMNCX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|