C20H29N3O4 — CID 22560685
4-[[(7-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]methyl]piperidine-1-carboxylic acid (PubChem CID 22560685) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is 4-[[(7-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]methyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[[(7-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 22560685 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 4-[[(7-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]methyl]piperidine-1-carboxylic acid |
| SMILES | CCCN(CC1CCN(C(=O)O)CC1)C1CCc2ccc([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C20H29N3O4/c1-2-9-22(14-15-7-10-21(11-8-15)20(24)25)18-5-3-16-4-6-19(23(26)27)13-17(16)12-18/h4,6,13,15,18H,2-3,5,7-12,14H2,1H3,(H,24,25) |
| InChIKey | CDYGMCFYGCOZND-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|