About butanamide;hydrochloride
butanamide;hydrochloride (PubChem CID 22560754) has the molecular formula C4H10ClNO
and a molecular weight of 123.58 g/mol. Its IUPAC name is butanamide;hydrochloride.
Molecular Properties
| Compound Name | butanamide;hydrochloride |
| PubChem CID | 22560754 |
| Molecular Formula | C4H10ClNO |
| Molecular Weight | 123.58 g/mol |
| Exact Mass | 123.05 |
| IUPAC Name | butanamide;hydrochloride |
| SMILES | CCCC(N)=O.Cl |
| InChI | InChI=1S/C4H9NO.ClH/c1-2-3-4(5)6;/h2-3H2,1H3,(H2,5,6);1H |
| InChIKey | ARUJJNVNLJPSDO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.58 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanamide;hydrochloride?
The IUPAC name of butanamide;hydrochloride (CID 22560754) is butanamide;hydrochloride.
What is the SMILES notation for butanamide;hydrochloride?
The canonical SMILES for butanamide;hydrochloride is CCCC(N)=O.Cl.
What is the InChIKey of butanamide;hydrochloride?
The InChIKey is ARUJJNVNLJPSDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.ClH/c1-2-3-4(5)6;/h2-3H2,1H3,(H2,5,6);1H.
What are the key properties of butanamide;hydrochloride?
butanamide;hydrochloride has a molecular weight of 123.58 g/mol, XLogP of 0.69, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butanamide;hydrochloride is sourced from PubChem (CID 22560754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).