About 2-methylpropanamide;hydrochloride
2-methylpropanamide;hydrochloride (PubChem CID 22560783) has the molecular formula C4H10ClNO
and a molecular weight of 123.58 g/mol. Its IUPAC name is 2-methylpropanamide;hydrochloride.
Molecular Properties
| Compound Name | 2-methylpropanamide;hydrochloride |
| PubChem CID | 22560783 |
| Molecular Formula | C4H10ClNO |
| Molecular Weight | 123.58 g/mol |
| Exact Mass | 123.05 |
| IUPAC Name | 2-methylpropanamide;hydrochloride |
| SMILES | CC(C)C(N)=O.Cl |
| InChI | InChI=1S/C4H9NO.ClH/c1-3(2)4(5)6;/h3H,1-2H3,(H2,5,6);1H |
| InChIKey | GZVUWANWWQXKQR-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.58 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylpropanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanamide;hydrochloride?
The IUPAC name of 2-methylpropanamide;hydrochloride (CID 22560783) is 2-methylpropanamide;hydrochloride.
What is the SMILES notation for 2-methylpropanamide;hydrochloride?
The canonical SMILES for 2-methylpropanamide;hydrochloride is CC(C)C(N)=O.Cl.
What is the InChIKey of 2-methylpropanamide;hydrochloride?
The InChIKey is GZVUWANWWQXKQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.ClH/c1-3(2)4(5)6;/h3H,1-2H3,(H2,5,6);1H.
What are the key properties of 2-methylpropanamide;hydrochloride?
2-methylpropanamide;hydrochloride has a molecular weight of 123.58 g/mol, XLogP of 0.55, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanamide;hydrochloride is sourced from PubChem (CID 22560783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).