C11H14Cl3NO3 — CID 22560928
2,2,2-trichloro-N-(7-methyl-3-methylidene-4,5,7,7a-tetrahydro-3aH-furo[2,3-c]pyran-5-yl)acetamide (PubChem CID 22560928) has the molecular formula C11H14Cl3NO3 and a molecular weight of 314.60 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(7-methyl-3-methylidene-4,5,7,7a-tetrahydro-3aH-furo[2,3-c]pyran-5-yl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(7-methyl-3-methylidene-4,5,7,7a-tetrahydro-3aH-furo[2,3-c]pyran-5-yl)acetamide |
|---|---|
| PubChem CID | 22560928 |
| Molecular Formula | C11H14Cl3NO3 |
| Molecular Weight | 314.60 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | 2,2,2-trichloro-N-(7-methyl-3-methylidene-4,5,7,7a-tetrahydro-3aH-furo[2,3-c]pyran-5-yl)acetamide |
| SMILES | C=C1COC2C(C)OC(NC(=O)C(Cl)(Cl)Cl)CC12 |
| InChI | InChI=1S/C11H14Cl3NO3/c1-5-4-17-9-6(2)18-8(3-7(5)9)15-10(16)11(12,13)14/h6-9H,1,3-4H2,2H3,(H,15,16) |
| InChIKey | JOERNZBGLWNXKA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.60 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|