C15H14O10 — CID 22561140
2-(3,5-dihydroxyphenoxy)carbonylcyclopentane-1,1,2-tricarboxylic acid (PubChem CID 22561140) has the molecular formula C15H14O10 and a molecular weight of 354.27 g/mol. Its IUPAC name is 2-(3,5-dihydroxyphenoxy)carbonylcyclopentane-1,1,2-tricarboxylic acid.
| Compound Name | 2-(3,5-dihydroxyphenoxy)carbonylcyclopentane-1,1,2-tricarboxylic acid |
|---|---|
| PubChem CID | 22561140 |
| Molecular Formula | C15H14O10 |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 2-(3,5-dihydroxyphenoxy)carbonylcyclopentane-1,1,2-tricarboxylic acid |
| SMILES | O=C(O)C1(C(=O)O)CCCC1(C(=O)O)C(=O)Oc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C15H14O10/c16-7-4-8(17)6-9(5-7)25-13(24)15(12(22)23)3-1-2-14(15,10(18)19)11(20)21/h4-6,16-17H,1-3H2,(H,18,19)(H,20,21)(H,22,23) |
| InChIKey | DGOLTXWJVIEZBL-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 178.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|