C46H44O4S2 — CID 22561173
1,2,2-trimethylcyclopentane-1,3-dicarboxylate;bis(triphenylsulfanium) (PubChem CID 22561173) has the molecular formula C46H44O4S2 and a molecular weight of 724.99 g/mol. Its IUPAC name is 1,2,2-trimethylcyclopentane-1,3-dicarboxylate;bis(triphenylsulfanium).
| Compound Name | 1,2,2-trimethylcyclopentane-1,3-dicarboxylate;bis(triphenylsulfanium) |
|---|---|
| PubChem CID | 22561173 |
| Molecular Formula | C46H44O4S2 |
| Molecular Weight | 724.99 g/mol |
| Exact Mass | 724.27 |
| IUPAC Name | 1,2,2-trimethylcyclopentane-1,3-dicarboxylate;bis(triphenylsulfanium) |
| SMILES | CC1(C(=O)[O-])CCC(C(=O)[O-])C1(C)C.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C18H15S.C10H16O4/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-9(2)6(7(11)12)4-5-10(9,3)8(13)14/h2*1-15H;6H,4-5H2,1-3H3,(H,11,12)(H,13,14)/q2*+1;/p-2 |
| InChIKey | AXNDKBZCUKSUOV-UHFFFAOYSA-L |
| XLogP | 8.49 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.99 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|