C24H21FN2O5 — CID 22561480
4,8-diamino-2-[4-(4-fluorobutoxy)phenyl]-1,5-dihydroxyanthracene-9,10-dione (PubChem CID 22561480) has the molecular formula C24H21FN2O5 and a molecular weight of 436.44 g/mol. Its IUPAC name is 4,8-diamino-2-[4-(4-fluorobutoxy)phenyl]-1,5-dihydroxyanthracene-9,10-dione.
| Compound Name | 4,8-diamino-2-[4-(4-fluorobutoxy)phenyl]-1,5-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 22561480 |
| Molecular Formula | C24H21FN2O5 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 4,8-diamino-2-[4-(4-fluorobutoxy)phenyl]-1,5-dihydroxyanthracene-9,10-dione |
| SMILES | Nc1ccc(O)c2c1C(=O)c1c(O)c(-c3ccc(OCCCCF)cc3)cc(N)c1C2=O |
| InChI | InChI=1S/C24H21FN2O5/c25-9-1-2-10-32-13-5-3-12(4-6-13)14-11-16(27)19-21(22(14)29)24(31)18-15(26)7-8-17(28)20(18)23(19)30/h3-8,11,28-29H,1-2,9-10,26-27H2 |
| InChIKey | OEWWESWGEWGBQW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|