C25H37F17O9Si — CID 22561493
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecan-2-yl-tris[2-(2-methoxyethoxy)ethoxy]silane (PubChem CID 22561493) has the molecular formula C25H37F17O9Si and a molecular weight of 832.61 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecan-2-yl-tris[2-(2-methoxyethoxy)ethoxy]silane.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecan-2-yl-tris[2-(2-methoxyethoxy)ethoxy]silane |
|---|---|
| PubChem CID | 22561493 |
| Molecular Formula | C25H37F17O9Si |
| Molecular Weight | 832.61 g/mol |
| Exact Mass | 832.19 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecan-2-yl-tris[2-(2-methoxyethoxy)ethoxy]silane |
| SMILES | COCCOCCO[Si](OCCOCCOC)(OCCOCCOC)C(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H37F17O9Si/c1-17(18(26,27)19(28,29)20(30,31)21(32,33)22(34,35)23(36,37)24(38,39)25(40,41)42)52(49-14-11-46-8-5-43-2,50-15-12-47-9-6-44-3)51-16-13-48-10-7-45-4/h17H,5-16H2,1-4H3 |
| InChIKey | FOGPDQLGAPSHOL-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.61 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|