About 4-(3-chlorophenyl)-1,3-dihydroindol-2-one
4-(3-chlorophenyl)-1,3-dihydroindol-2-one (PubChem CID 22561798) has the molecular formula C14H10ClNO
and a molecular weight of 243.69 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 4-(3-chlorophenyl)-1,3-dihydroindol-2-one |
| PubChem CID | 22561798 |
| Molecular Formula | C14H10ClNO |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 4-(3-chlorophenyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2c(cccc2-c2cccc(Cl)c2)N1 |
| InChI | InChI=1S/C14H10ClNO/c15-10-4-1-3-9(7-10)11-5-2-6-13-12(11)8-14(17)16-13/h1-7H,8H2,(H,16,17) |
| InChIKey | QVMQXLNGOIFEGJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(3-chlorophenyl)-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chlorophenyl)-1,3-dihydroindol-2-one?
The IUPAC name of 4-(3-chlorophenyl)-1,3-dihydroindol-2-one (CID 22561798) is 4-(3-chlorophenyl)-1,3-dihydroindol-2-one.
What is the SMILES notation for 4-(3-chlorophenyl)-1,3-dihydroindol-2-one?
The canonical SMILES for 4-(3-chlorophenyl)-1,3-dihydroindol-2-one is O=C1Cc2c(cccc2-c2cccc(Cl)c2)N1.
What is the InChIKey of 4-(3-chlorophenyl)-1,3-dihydroindol-2-one?
The InChIKey is QVMQXLNGOIFEGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClNO/c15-10-4-1-3-9(7-10)11-5-2-6-13-12(11)8-14(17)16-13/h1-7H,8H2,(H,16,17).
What are the key properties of 4-(3-chlorophenyl)-1,3-dihydroindol-2-one?
4-(3-chlorophenyl)-1,3-dihydroindol-2-one has a molecular weight of 243.69 g/mol, XLogP of 3.50, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chlorophenyl)-1,3-dihydroindol-2-one is sourced from PubChem (CID 22561798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).