About 2-fluoro-5-(2-oxo-1,3-dihydroindol-4-yl)benzonitrile
2-fluoro-5-(2-oxo-1,3-dihydroindol-4-yl)benzonitrile (PubChem CID 22561891) has the molecular formula C15H9FN2O
and a molecular weight of 252.25 g/mol. Its IUPAC name is 2-fluoro-5-(2-oxo-1,3-dihydroindol-4-yl)benzonitrile.
Molecular Properties
| Compound Name | 2-fluoro-5-(2-oxo-1,3-dihydroindol-4-yl)benzonitrile |
| PubChem CID | 22561891 |
| Molecular Formula | C15H9FN2O |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2-fluoro-5-(2-oxo-1,3-dihydroindol-4-yl)benzonitrile |
| SMILES | N#Cc1cc(-c2cccc3c2CC(=O)N3)ccc1F |
| InChI | InChI=1S/C15H9FN2O/c16-13-5-4-9(6-10(13)8-17)11-2-1-3-14-12(11)7-15(19)18-14/h1-6H,7H2,(H,18,19) |
| InChIKey | NHCRDKAWLGXHQO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluoro-5-(2-oxo-1,3-dihydroindol-4-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5-(2-oxo-1,3-dihydroindol-4-yl)benzonitrile?
The IUPAC name of 2-fluoro-5-(2-oxo-1,3-dihydroindol-4-yl)benzonitrile (CID 22561891) is 2-fluoro-5-(2-oxo-1,3-dihydroindol-4-yl)benzonitrile.
What is the SMILES notation for 2-fluoro-5-(2-oxo-1,3-dihydroindol-4-yl)benzonitrile?
The canonical SMILES for 2-fluoro-5-(2-oxo-1,3-dihydroindol-4-yl)benzonitrile is N#Cc1cc(-c2cccc3c2CC(=O)N3)ccc1F.
What is the InChIKey of 2-fluoro-5-(2-oxo-1,3-dihydroindol-4-yl)benzonitrile?
The InChIKey is NHCRDKAWLGXHQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9FN2O/c16-13-5-4-9(6-10(13)8-17)11-2-1-3-14-12(11)7-15(19)18-14/h1-6H,7H2,(H,18,19).
What are the key properties of 2-fluoro-5-(2-oxo-1,3-dihydroindol-4-yl)benzonitrile?
2-fluoro-5-(2-oxo-1,3-dihydroindol-4-yl)benzonitrile has a molecular weight of 252.25 g/mol, XLogP of 2.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5-(2-oxo-1,3-dihydroindol-4-yl)benzonitrile is sourced from PubChem (CID 22561891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).