C20H23NO5S — CID 22562091
6-methyl-3-[7-(2,3,4-trimethoxyphenyl)-2,3,6,7-tetrahydro-1,4-thiazepin-5-yl]pyran-2-one (PubChem CID 22562091) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is 6-methyl-3-[7-(2,3,4-trimethoxyphenyl)-2,3,6,7-tetrahydro-1,4-thiazepin-5-yl]pyran-2-one.
| Compound Name | 6-methyl-3-[7-(2,3,4-trimethoxyphenyl)-2,3,6,7-tetrahydro-1,4-thiazepin-5-yl]pyran-2-one |
|---|---|
| PubChem CID | 22562091 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 6-methyl-3-[7-(2,3,4-trimethoxyphenyl)-2,3,6,7-tetrahydro-1,4-thiazepin-5-yl]pyran-2-one |
| SMILES | COc1ccc(C2CC(c3ccc(C)oc3=O)=NCCS2)c(OC)c1OC |
| InChI | InChI=1S/C20H23NO5S/c1-12-5-6-13(20(22)26-12)15-11-17(27-10-9-21-15)14-7-8-16(23-2)19(25-4)18(14)24-3/h5-8,17H,9-11H2,1-4H3 |
| InChIKey | PQHGVDZIJBYWQT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 70.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |