C5H9NO2S — CID 22562113
2,3,6,7-tetrahydro-1,4-thiazepine 1,1-dioxide (PubChem CID 22562113) has the molecular formula C5H9NO2S and a molecular weight of 147.20 g/mol. Its IUPAC name is 2,3,6,7-tetrahydro-1,4-thiazepine 1,1-dioxide.
| Compound Name | 2,3,6,7-tetrahydro-1,4-thiazepine 1,1-dioxide |
|---|---|
| PubChem CID | 22562113 |
| Molecular Formula | C5H9NO2S |
| Molecular Weight | 147.20 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | 2,3,6,7-tetrahydro-1,4-thiazepine 1,1-dioxide |
| SMILES | O=S1(=O)CCC=NCC1 |
| InChI | InChI=1S/C5H9NO2S/c7-9(8)4-1-2-6-3-5-9/h2H,1,3-5H2 |
| InChIKey | DCZJSRCRFVVJOU-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.20 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |