C22H22ClFN2O5S — CID 22562309
[2-[3-(4-chlorophenyl)propyl]-6-(3-fluoro-4-methoxyphenyl)-3-oxopyridazin-4-yl]methyl methanesulfonate (PubChem CID 22562309) has the molecular formula C22H22ClFN2O5S and a molecular weight of 480.95 g/mol. Its IUPAC name is [2-[3-(4-chlorophenyl)propyl]-6-(3-fluoro-4-methoxyphenyl)-3-oxopyridazin-4-yl]methyl methanesulfonate.
| Compound Name | [2-[3-(4-chlorophenyl)propyl]-6-(3-fluoro-4-methoxyphenyl)-3-oxopyridazin-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 22562309 |
| Molecular Formula | C22H22ClFN2O5S |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | [2-[3-(4-chlorophenyl)propyl]-6-(3-fluoro-4-methoxyphenyl)-3-oxopyridazin-4-yl]methyl methanesulfonate |
| SMILES | COc1ccc(-c2cc(COS(C)(=O)=O)c(=O)n(CCCc3ccc(Cl)cc3)n2)cc1F |
| InChI | InChI=1S/C22H22ClFN2O5S/c1-30-21-10-7-16(12-19(21)24)20-13-17(14-31-32(2,28)29)22(27)26(25-20)11-3-4-15-5-8-18(23)9-6-15/h5-10,12-13H,3-4,11,14H2,1-2H3 |
| InChIKey | RLGHJMILMVLITP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|