C27H37F3N4O5S2 — CID 22562573
5,5-dimethyl-3-(1-oxo-3H-2-benzofuran-5-yl)-2-sulfanylidene-1-[8-[4-(2,2,2-trifluoroethylsulfonyl)piperazin-1-yl]octyl]imidazolidin-4-one (PubChem CID 22562573) has the molecular formula C27H37F3N4O5S2 and a molecular weight of 618.74 g/mol. Its IUPAC name is 5,5-dimethyl-3-(1-oxo-3H-2-benzofuran-5-yl)-2-sulfanylidene-1-[8-[4-(2,2,2-trifluoroethylsulfonyl)piperazin-1-yl]octyl]imidazolidin-4-one.
| Compound Name | 5,5-dimethyl-3-(1-oxo-3H-2-benzofuran-5-yl)-2-sulfanylidene-1-[8-[4-(2,2,2-trifluoroethylsulfonyl)piperazin-1-yl]octyl]imidazolidin-4-one |
|---|---|
| PubChem CID | 22562573 |
| Molecular Formula | C27H37F3N4O5S2 |
| Molecular Weight | 618.74 g/mol |
| Exact Mass | 618.22 |
| IUPAC Name | 5,5-dimethyl-3-(1-oxo-3H-2-benzofuran-5-yl)-2-sulfanylidene-1-[8-[4-(2,2,2-trifluoroethylsulfonyl)piperazin-1-yl]octyl]imidazolidin-4-one |
| SMILES | CC1(C)C(=O)N(c2ccc3c(c2)COC3=O)C(=S)N1CCCCCCCCN1CCN(S(=O)(=O)CC(F)(F)F)CC1 |
| InChI | InChI=1S/C27H37F3N4O5S2/c1-26(2)24(36)34(21-9-10-22-20(17-21)18-39-23(22)35)25(40)33(26)12-8-6-4-3-5-7-11-31-13-15-32(16-14-31)41(37,38)19-27(28,29)30/h9-10,17H,3-8,11-16,18-19H2,1-2H3 |
| InChIKey | PWLQARKNBGWWSP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 90.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.74 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|