C26H36N4O3S2 — CID 22562823
S-methyl 4-[6-[5,5-dimethyl-4-oxo-3-(1-oxo-2,3-dihydroinden-5-yl)-2-sulfanylideneimidazolidin-1-yl]hexyl]piperazine-1-carbothioate (PubChem CID 22562823) has the molecular formula C26H36N4O3S2 and a molecular weight of 516.73 g/mol. Its IUPAC name is S-methyl 4-[6-[5,5-dimethyl-4-oxo-3-(1-oxo-2,3-dihydroinden-5-yl)-2-sulfanylideneimidazolidin-1-yl]hexyl]piperazine-1-carbothioate.
| Compound Name | S-methyl 4-[6-[5,5-dimethyl-4-oxo-3-(1-oxo-2,3-dihydroinden-5-yl)-2-sulfanylideneimidazolidin-1-yl]hexyl]piperazine-1-carbothioate |
|---|---|
| PubChem CID | 22562823 |
| Molecular Formula | C26H36N4O3S2 |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | S-methyl 4-[6-[5,5-dimethyl-4-oxo-3-(1-oxo-2,3-dihydroinden-5-yl)-2-sulfanylideneimidazolidin-1-yl]hexyl]piperazine-1-carbothioate |
| SMILES | CSC(=O)N1CCN(CCCCCCN2C(=S)N(c3ccc4c(c3)CCC4=O)C(=O)C2(C)C)CC1 |
| InChI | InChI=1S/C26H36N4O3S2/c1-26(2)23(32)30(20-9-10-21-19(18-20)8-11-22(21)31)24(34)29(26)13-7-5-4-6-12-27-14-16-28(17-15-27)25(33)35-3/h9-10,18H,4-8,11-17H2,1-3H3 |
| InChIKey | LYGIYGDCGPKHPI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|