C30H34F3N5O3S — CID 22562929
4-[6-[1-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-2,5-dioxopyrrol-3-yl]hexyl]-N-(2-thiophen-2-ylethyl)piperazine-1-carboxamide (PubChem CID 22562929) has the molecular formula C30H34F3N5O3S and a molecular weight of 601.70 g/mol. Its IUPAC name is 4-[6-[1-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-2,5-dioxopyrrol-3-yl]hexyl]-N-(2-thiophen-2-ylethyl)piperazine-1-carboxamide.
| Compound Name | 4-[6-[1-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-2,5-dioxopyrrol-3-yl]hexyl]-N-(2-thiophen-2-ylethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 22562929 |
| Molecular Formula | C30H34F3N5O3S |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | 4-[6-[1-[4-cyano-3-(trifluoromethyl)phenyl]-4-methyl-2,5-dioxopyrrol-3-yl]hexyl]-N-(2-thiophen-2-ylethyl)piperazine-1-carboxamide |
| SMILES | CC1=C(CCCCCCN2CCN(C(=O)NCCc3cccs3)CC2)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C30H34F3N5O3S/c1-21-25(28(40)38(27(21)39)23-10-9-22(20-34)26(19-23)30(31,32)33)8-4-2-3-5-13-36-14-16-37(17-15-36)29(41)35-12-11-24-7-6-18-42-24/h6-7,9-10,18-19H,2-5,8,11-17H2,1H3,(H,35,41) |
| InChIKey | DXYPPISGVZWYHX-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|