C6H10ClN5 — CID 22563
6-chloro-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine (PubChem CID 22563) has the molecular formula C6H10ClN5 and a molecular weight of 187.63 g/mol. Its IUPAC name is 6-chloro-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 22563 |
| Molecular Formula | C6H10ClN5 |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 6-chloro-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)Nc1nc(N)nc(Cl)n1 |
| InChI | InChI=1S/C6H10ClN5/c1-3(2)9-6-11-4(7)10-5(8)12-6/h3H,1-2H3,(H3,8,9,10,11,12) |
| InChIKey | DFWFIQKMSFGDCQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |