About 2-chloroprop-2-enyl thiocyanate
2-chloroprop-2-enyl thiocyanate (PubChem CID 22563699) has the molecular formula C4H4ClNS
and a molecular weight of 133.60 g/mol. Its IUPAC name is 2-chloroprop-2-enyl thiocyanate.
Molecular Properties
| Compound Name | 2-chloroprop-2-enyl thiocyanate |
| PubChem CID | 22563699 |
| Molecular Formula | C4H4ClNS |
| Molecular Weight | 133.60 g/mol |
| Exact Mass | 132.98 |
| IUPAC Name | 2-chloroprop-2-enyl thiocyanate |
| SMILES | C=C(Cl)CSC#N |
| InChI | InChI=1S/C4H4ClNS/c1-4(5)2-7-3-6/h1-2H2 |
| InChIKey | ZHAPHEOOARQZIE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.60 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroprop-2-enyl thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroprop-2-enyl thiocyanate?
The IUPAC name of 2-chloroprop-2-enyl thiocyanate (CID 22563699) is 2-chloroprop-2-enyl thiocyanate.
What is the SMILES notation for 2-chloroprop-2-enyl thiocyanate?
The canonical SMILES for 2-chloroprop-2-enyl thiocyanate is C=C(Cl)CSC#N.
What is the InChIKey of 2-chloroprop-2-enyl thiocyanate?
The InChIKey is ZHAPHEOOARQZIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4ClNS/c1-4(5)2-7-3-6/h1-2H2.
What are the key properties of 2-chloroprop-2-enyl thiocyanate?
2-chloroprop-2-enyl thiocyanate has a molecular weight of 133.60 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroprop-2-enyl thiocyanate is sourced from PubChem (CID 22563699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).