About hexanamide;dihydrochloride
hexanamide;dihydrochloride (PubChem CID 22563872) has the molecular formula C6H15Cl2NO
and a molecular weight of 188.10 g/mol. Its IUPAC name is hexanamide;dihydrochloride.
Molecular Properties
| Compound Name | hexanamide;dihydrochloride |
| PubChem CID | 22563872 |
| Molecular Formula | C6H15Cl2NO |
| Molecular Weight | 188.10 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | hexanamide;dihydrochloride |
| SMILES | CCCCCC(N)=O.Cl.Cl |
| InChI | InChI=1S/C6H13NO.2ClH/c1-2-3-4-5-6(7)8;;/h2-5H2,1H3,(H2,7,8);2*1H |
| InChIKey | XGUFRJDLLIMYOT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.10 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexanamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanamide;dihydrochloride?
The IUPAC name of hexanamide;dihydrochloride (CID 22563872) is hexanamide;dihydrochloride.
What is the SMILES notation for hexanamide;dihydrochloride?
The canonical SMILES for hexanamide;dihydrochloride is CCCCCC(N)=O.Cl.Cl.
What is the InChIKey of hexanamide;dihydrochloride?
The InChIKey is XGUFRJDLLIMYOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.2ClH/c1-2-3-4-5-6(7)8;;/h2-5H2,1H3,(H2,7,8);2*1H.
What are the key properties of hexanamide;dihydrochloride?
hexanamide;dihydrochloride has a molecular weight of 188.10 g/mol, XLogP of 1.90, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexanamide;dihydrochloride is sourced from PubChem (CID 22563872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).