C12H21NOSi — CID 22564674
N-[dimethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silyl]formamide (PubChem CID 22564674) has the molecular formula C12H21NOSi and a molecular weight of 223.39 g/mol. Its IUPAC name is N-[dimethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silyl]formamide.
| Compound Name | N-[dimethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silyl]formamide |
|---|---|
| PubChem CID | 22564674 |
| Molecular Formula | C12H21NOSi |
| Molecular Weight | 223.39 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | N-[dimethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silyl]formamide |
| SMILES | CC1=C(C)C(C)C([Si](C)(C)NC=O)=C1C |
| InChI | InChI=1S/C12H21NOSi/c1-8-9(2)11(4)12(10(8)3)15(5,6)13-7-14/h7,10H,1-6H3,(H,13,14) |
| InChIKey | BCRMDBSCZSLFAG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|