About 3-(methoxymethyl)-2,2-dimethylcyclopropane-1-carboxylate
3-(methoxymethyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 22564701) has the molecular formula C8H13O3-
and a molecular weight of 157.19 g/mol. Its IUPAC name is 3-(methoxymethyl)-2,2-dimethylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | 3-(methoxymethyl)-2,2-dimethylcyclopropane-1-carboxylate |
| PubChem CID | 22564701 |
| Molecular Formula | C8H13O3- |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 3-(methoxymethyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | COCC1C(C(=O)[O-])C1(C)C |
| InChI | InChI=1S/C8H14O3/c1-8(2)5(4-11-3)6(8)7(9)10/h5-6H,4H2,1-3H3,(H,9,10)/p-1 |
| InChIKey | RFIBAKPNIKECNC-UHFFFAOYSA-M |
| XLogP | -0.35 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(methoxymethyl)-2,2-dimethylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methoxymethyl)-2,2-dimethylcyclopropane-1-carboxylate?
The IUPAC name of 3-(methoxymethyl)-2,2-dimethylcyclopropane-1-carboxylate (CID 22564701) is 3-(methoxymethyl)-2,2-dimethylcyclopropane-1-carboxylate.
What is the SMILES notation for 3-(methoxymethyl)-2,2-dimethylcyclopropane-1-carboxylate?
The canonical SMILES for 3-(methoxymethyl)-2,2-dimethylcyclopropane-1-carboxylate is COCC1C(C(=O)[O-])C1(C)C.
What is the InChIKey of 3-(methoxymethyl)-2,2-dimethylcyclopropane-1-carboxylate?
The InChIKey is RFIBAKPNIKECNC-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H14O3/c1-8(2)5(4-11-3)6(8)7(9)10/h5-6H,4H2,1-3H3,(H,9,10)/p-1.
What are the key properties of 3-(methoxymethyl)-2,2-dimethylcyclopropane-1-carboxylate?
3-(methoxymethyl)-2,2-dimethylcyclopropane-1-carboxylate has a molecular weight of 157.19 g/mol, XLogP of -0.35, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methoxymethyl)-2,2-dimethylcyclopropane-1-carboxylate is sourced from PubChem (CID 22564701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).