C19H23N3O4S — CID 22564745
N-butyl-3-[(2-methylphenyl)sulfonylcarbamoylamino]benzamide (PubChem CID 22564745) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-butyl-3-[(2-methylphenyl)sulfonylcarbamoylamino]benzamide.
| Compound Name | N-butyl-3-[(2-methylphenyl)sulfonylcarbamoylamino]benzamide |
|---|---|
| PubChem CID | 22564745 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-butyl-3-[(2-methylphenyl)sulfonylcarbamoylamino]benzamide |
| SMILES | CCCCNC(=O)c1cccc(NC(=O)NS(=O)(=O)c2ccccc2C)c1 |
| InChI | InChI=1S/C19H23N3O4S/c1-3-4-12-20-18(23)15-9-7-10-16(13-15)21-19(24)22-27(25,26)17-11-6-5-8-14(17)2/h5-11,13H,3-4,12H2,1-2H3,(H,20,23)(H2,21,22,24) |
| InChIKey | XXDFMGXAXSIYMG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|