About 1H-naphthalene-2,2-diol
1H-naphthalene-2,2-diol (PubChem CID 22565012) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol. Its IUPAC name is 1H-naphthalene-2,2-diol.
Molecular Properties
| Compound Name | 1H-naphthalene-2,2-diol |
| PubChem CID | 22565012 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 1H-naphthalene-2,2-diol |
| SMILES | OC1(O)C=Cc2ccccc2C1 |
| InChI | InChI=1S/C10H10O2/c11-10(12)6-5-8-3-1-2-4-9(8)7-10/h1-6,11-12H,7H2 |
| InChIKey | JXVVASBGLGTWLD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1H-naphthalene-2,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-naphthalene-2,2-diol?
The IUPAC name of 1H-naphthalene-2,2-diol (CID 22565012) is 1H-naphthalene-2,2-diol.
What is the SMILES notation for 1H-naphthalene-2,2-diol?
The canonical SMILES for 1H-naphthalene-2,2-diol is OC1(O)C=Cc2ccccc2C1.
What is the InChIKey of 1H-naphthalene-2,2-diol?
The InChIKey is JXVVASBGLGTWLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2/c11-10(12)6-5-8-3-1-2-4-9(8)7-10/h1-6,11-12H,7H2.
What are the key properties of 1H-naphthalene-2,2-diol?
1H-naphthalene-2,2-diol has a molecular weight of 162.19 g/mol, XLogP of 0.94, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-naphthalene-2,2-diol is sourced from PubChem (CID 22565012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).