C13H10N2O5 — CID 22565263
5-nitro-6-phenylmethoxypyridine-2-carboxylic acid (PubChem CID 22565263) has the molecular formula C13H10N2O5 and a molecular weight of 274.23 g/mol. Its IUPAC name is 5-nitro-6-phenylmethoxypyridine-2-carboxylic acid.
| Compound Name | 5-nitro-6-phenylmethoxypyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 22565263 |
| Molecular Formula | C13H10N2O5 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 5-nitro-6-phenylmethoxypyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])c(OCc2ccccc2)n1 |
| InChI | InChI=1S/C13H10N2O5/c16-13(17)10-6-7-11(15(18)19)12(14-10)20-8-9-4-2-1-3-5-9/h1-7H,8H2,(H,16,17) |
| InChIKey | PHKLKEKFKXTMOR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|