C22H19N5O5S — CID 22565440
2-cyclopropyl-5-[8-methyl-5-(4-nitrophenyl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-7-yl]-1,2,4-thiadiazol-3-one (PubChem CID 22565440) has the molecular formula C22H19N5O5S and a molecular weight of 465.49 g/mol. Its IUPAC name is 2-cyclopropyl-5-[8-methyl-5-(4-nitrophenyl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-7-yl]-1,2,4-thiadiazol-3-one.
| Compound Name | 2-cyclopropyl-5-[8-methyl-5-(4-nitrophenyl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-7-yl]-1,2,4-thiadiazol-3-one |
|---|---|
| PubChem CID | 22565440 |
| Molecular Formula | C22H19N5O5S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 2-cyclopropyl-5-[8-methyl-5-(4-nitrophenyl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-7-yl]-1,2,4-thiadiazol-3-one |
| SMILES | CC1Cc2cc3c(cc2C(c2ccc([N+](=O)[O-])cc2)=NN1c1nc(=O)n(C2CC2)s1)OCO3 |
| InChI | InChI=1S/C22H19N5O5S/c1-12-8-14-9-18-19(32-11-31-18)10-17(14)20(13-2-4-16(5-3-13)27(29)30)24-25(12)22-23-21(28)26(33-22)15-6-7-15/h2-5,9-10,12,15H,6-8,11H2,1H3 |
| InChIKey | OPNOAGMBSBADLQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 112.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|