C23H23N5O3S — CID 22565456
N-[2-methyl-4-[8-methyl-7-(5-methyl-1,3,4-thiadiazol-2-yl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-5-yl]phenyl]acetamide (PubChem CID 22565456) has the molecular formula C23H23N5O3S and a molecular weight of 449.54 g/mol. Its IUPAC name is N-[2-methyl-4-[8-methyl-7-(5-methyl-1,3,4-thiadiazol-2-yl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-5-yl]phenyl]acetamide.
| Compound Name | N-[2-methyl-4-[8-methyl-7-(5-methyl-1,3,4-thiadiazol-2-yl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-5-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 22565456 |
| Molecular Formula | C23H23N5O3S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | N-[2-methyl-4-[8-methyl-7-(5-methyl-1,3,4-thiadiazol-2-yl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-5-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2=NN(c3nnc(C)s3)C(C)Cc3cc4c(cc32)OCO4)cc1C |
| InChI | InChI=1S/C23H23N5O3S/c1-12-7-16(5-6-19(12)24-14(3)29)22-18-10-21-20(30-11-31-21)9-17(18)8-13(2)28(27-22)23-26-25-15(4)32-23/h5-7,9-10,13H,8,11H2,1-4H3,(H,24,29) |
| InChIKey | KSSNZEOAUIDIMP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |