About 2-butylspiro[2.2]pentane
2-butylspiro[2.2]pentane (PubChem CID 22566) has the molecular formula C9H16
and a molecular weight of 124.23 g/mol. Its IUPAC name is 2-butylspiro[2.2]pentane.
Molecular Properties
| Compound Name | 2-butylspiro[2.2]pentane |
| PubChem CID | 22566 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | 2-butylspiro[2.2]pentane |
| SMILES | CCCCC1CC12CC2 |
| InChI | InChI=1S/C9H16/c1-2-3-4-8-7-9(8)5-6-9/h8H,2-7H2,1H3 |
| InChIKey | TYYFRIFTXPYWNJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-butylspiro[2.2]pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylspiro[2.2]pentane?
The IUPAC name of 2-butylspiro[2.2]pentane (CID 22566) is 2-butylspiro[2.2]pentane.
What is the SMILES notation for 2-butylspiro[2.2]pentane?
The canonical SMILES for 2-butylspiro[2.2]pentane is CCCCC1CC12CC2.
What is the InChIKey of 2-butylspiro[2.2]pentane?
The InChIKey is TYYFRIFTXPYWNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16/c1-2-3-4-8-7-9(8)5-6-9/h8H,2-7H2,1H3.
What are the key properties of 2-butylspiro[2.2]pentane?
2-butylspiro[2.2]pentane has a molecular weight of 124.23 g/mol, XLogP of 2.98, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylspiro[2.2]pentane is sourced from PubChem (CID 22566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).