About N-[5-[(3,5-difluorophenyl)sulfonylamino]-1H-indazol-3-yl]benzamide
N-[5-[(3,5-difluorophenyl)sulfonylamino]-1H-indazol-3-yl]benzamide (PubChem CID 22567035) has the molecular formula C20H14F2N4O3S
and a molecular weight of 428.42 g/mol. Its IUPAC name is N-[5-[(3,5-difluorophenyl)sulfonylamino]-1H-indazol-3-yl]benzamide.
Molecular Properties
| Compound Name | N-[5-[(3,5-difluorophenyl)sulfonylamino]-1H-indazol-3-yl]benzamide |
| PubChem CID | 22567035 |
| Molecular Formula | C20H14F2N4O3S |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | N-[5-[(3,5-difluorophenyl)sulfonylamino]-1H-indazol-3-yl]benzamide |
| SMILES | O=C(Nc1n[nH]c2ccc(NS(=O)(=O)c3cc(F)cc(F)c3)cc12)c1ccccc1 |
| InChI | InChI=1S/C20H14F2N4O3S/c21-13-8-14(22)10-16(9-13)30(28,29)26-15-6-7-18-17(11-15)19(25-24-18)23-20(27)12-4-2-1-3-5-12/h1-11,26H,(H2,23,24,25,27) |
| InChIKey | QADQJUPWUGQXEW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[5-[(3,5-difluorophenyl)sulfonylamino]-1H-indazol-3-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[(3,5-difluorophenyl)sulfonylamino]-1H-indazol-3-yl]benzamide?
The IUPAC name of N-[5-[(3,5-difluorophenyl)sulfonylamino]-1H-indazol-3-yl]benzamide (CID 22567035) is N-[5-[(3,5-difluorophenyl)sulfonylamino]-1H-indazol-3-yl]benzamide.
What is the SMILES notation for N-[5-[(3,5-difluorophenyl)sulfonylamino]-1H-indazol-3-yl]benzamide?
The canonical SMILES for N-[5-[(3,5-difluorophenyl)sulfonylamino]-1H-indazol-3-yl]benzamide is O=C(Nc1n[nH]c2ccc(NS(=O)(=O)c3cc(F)cc(F)c3)cc12)c1ccccc1.
What is the InChIKey of N-[5-[(3,5-difluorophenyl)sulfonylamino]-1H-indazol-3-yl]benzamide?
The InChIKey is QADQJUPWUGQXEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14F2N4O3S/c21-13-8-14(22)10-16(9-13)30(28,29)26-15-6-7-18-17(11-15)19(25-24-18)23-20(27)12-4-2-1-3-5-12/h1-11,26H,(H2,23,24,25,27).
What are the key properties of N-[5-[(3,5-difluorophenyl)sulfonylamino]-1H-indazol-3-yl]benzamide?
N-[5-[(3,5-difluorophenyl)sulfonylamino]-1H-indazol-3-yl]benzamide has a molecular weight of 428.42 g/mol, XLogP of 3.89, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[(3,5-difluorophenyl)sulfonylamino]-1H-indazol-3-yl]benzamide is sourced from PubChem (CID 22567035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).